CAS 130742-22-2: 4-Isoxazolecarboxylicacid,3-bromo-5-methyl-(9CI)

Description:4-Isoxazolecarboxylic acid, 3-bromo-5-methyl- (9CI), with the CAS number 130742-22-2, is an organic compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a carboxylic acid functional group, contributing to its acidic properties. The presence of bromine and a methyl group at specific positions on the isoxazole ring influences its reactivity and potential applications in various chemical reactions. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 4-Isoxazolecarboxylic acid, 3-bromo-5-methyl- is a compound of interest in organic synthesis and medicinal chemistry due to its unique structural features and potential applications.

Formula:C₅H₄BrNO₃

InChI:InChI=1/C5H4BrNO3/c1-2-3(5(8)9)4(6)7-10-2/h1H3,(H,8,9)

Synonyms:
3-Bromo-5-methyl-1,2-oxazole-4-carboxylic acid
4-Isoxazolecarboxylic acid, 3-bromo-5-methyl-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Bromo-5-methylisoxazole-4-carboxylic acid REF: BD-BD162828CAS: 130742-22-2	96%	To inquire	Fri 21 Mar 25
4-Isoxazolecarboxylic acid, 3-bromo-5-methyl- REF: IN-DA000UWYCAS: 130742-22-2	- - -	To inquire	Thu 27 Mar 25
3-Bromo-5-methylisoxazole-4-carboxylic acid REF: 3D-FFA74222CAS: 130742-22-2	Min. 95%	To inquire	Mon 07 Apr 25
3-Bromo-5-methyl-1,2-oxazole-4-carboxylic acid REF: 10-F718344CAS: 130742-22-2	96%	- - -	Discontinued product