CAS 13088-64-7: N-(Hydroxymethyl)caprolactam
Description:N-(Hydroxymethyl)caprolactam is an organic compound characterized by its lactam structure, which is a cyclic amide derived from caprolactam. It features a hydroxymethyl group (-CH2OH) attached to the nitrogen atom of the lactam ring, enhancing its reactivity and solubility in polar solvents. This compound is typically a white to off-white solid at room temperature and is known for its ability to participate in various chemical reactions, including polymerization and cross-linking processes. It is often utilized in the synthesis of polyamide resins and as an intermediate in the production of specialty chemicals. The presence of the hydroxymethyl group can also impart additional functionalities, making it valuable in applications such as coatings, adhesives, and other polymer-based materials. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to minimize exposure and environmental impact.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c9-6-8-5-3-1-2-4-7(8)10/h9H,1-6H2
InChI key:InChIKey=QBUDWHWPQWURCC-UHFFFAOYSA-N
SMILES:O=C1N(CO)CCCCC1
- Synonyms:
- 1-(Hydroxymethyl)Azepan-2-One
- 2H-Azepin-2-one, hexahydro-1-(hydroxymethyl)-
- N-(Hydroxymethyl)-2-caprolactam
- N-(Hydroxymethyl)caprolactam
- N-Methylolcaprolactam
- Hexahydro-1-(hydroxymethyl)-2H-azepin-2-one
2H-Azepin-2-one, hexahydro-1-(hydroxymethyl)-
Ref: IN-DA000V2I
| Undefined size | To inquire |
Ref: 10-F657542
| 100mg | To inquire | ||
| 250mg | To inquire |
1-(Hydroxymethyl)azepan-2-one
Ref: 3D-NAA08864
| 5g | 1,845.00 € | ||
| 500mg | 531.00 € |
