CAS 1309081-44-4: 1-(1-Methyl-1H-pyrazol-4-yl)-2-piperazinone

Description: 1-(1-Methyl-1H-pyrazol-4-yl)-2-piperazinone is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a piperazinone moiety. The presence of the methyl group on the pyrazole ring contributes to its stability and reactivity. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for many heterocyclic compounds. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The piperazinone structure can influence its pharmacokinetic properties, including absorption and distribution in biological systems. Additionally, the compound may participate in hydrogen bonding due to the presence of nitrogen atoms in both the pyrazole and piperazine rings, potentially affecting its interactions with biological targets. Overall, 1-(1-Methyl-1H-pyrazol-4-yl)-2-piperazinone is a versatile compound with potential applications in various fields, particularly in the development of pharmaceuticals.

Formula: C₈H₁₂N₄O

InChI: InChI=1S/C8H12N4O/c1-11-6-7(4-10-11)12-3-2-9-5-8(12)13/h4,6,9H,2-3,5H2,1H3

InChI key: InChIKey=QWCNINBVJBCGES-UHFFFAOYSA-N

SMILES: O=C1N(C=2C=NN(C2)C)CCNC1

Synonyms:

• 2-Piperazinone, 1-(1-methyl-1H-pyrazol-4-yl)-
• 1-(1-Methyl-1H-pyrazol-4-yl)-2-piperazinone

1-(1-Methyl-1H-pyrazol-4-yl)piperazin-2-one

CAS: 1309081-44-4

Versatile small molecule scaffold

• Formula: C₈H₁₂N₄O
• Purity: Min. 95%
• Molecular weight: 180.21 g/mol

1-(1-Methyl-1h-pyrazol-4-yl)piperazin-2-one

CAS: 1309081-44-4

• Purity: 95%
• Molecular weight: 180.21099853515625