CAS 1310680-31-9: (3S)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic acid

Description:The chemical substance known as (3S)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic acid is a synthetic compound that features a trifluorobutanoic acid moiety, which contributes to its unique properties. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates its use in peptide synthesis, particularly as a protecting group for amino acids. This compound is characterized by its chiral center, which is denoted by the (3S) configuration, influencing its biological activity and interactions. The trifluoromethyl group enhances lipophilicity and can affect the compound's solubility and reactivity. Additionally, the presence of the carboxylic acid functional group suggests potential for hydrogen bonding and reactivity in various chemical environments. Overall, this compound is significant in the field of medicinal chemistry and peptide synthesis, where its structural features can be leveraged for the development of bioactive molecules.

Formula:C₁₉H₁₆F₃NO₄

InChI:InChI=1S/C19H16F3NO4/c20-19(21,22)16(9-17(24)25)23-18(26)27-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H,23,26)(H,24,25)/t16-/m0/s1

InChI key:InChIKey=WCJXAGGMJPEDDU-INIZCTEOSA-N

SMILES:O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NC(CC(=O)O)C(F)(F)F

Synonyms:
Butanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluoro-, (3S)-
(3S)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
(S)-Fmoc-3-amino-4,4,4-trifluorobutyric acid REF: 54-PC106199CAS: 1310680-31-9	- - -	770.00 €~2,054.00 €	Fri 28 Mar 25
(S)-Fmoc-3-amino-4,4,4-trifluoro-butyric acid REF: 10-F494310CAS: 1310680-31-9	99.0%	- - -	Discontinued product
(S)-Fmoc-3-amino-4,4,4-trifluoro-butyric acid REF: 3D-KCC68031CAS: 1310680-31-9	Min. 95%	- - -	Discontinued product