Product correctly added to cart.

α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-1-naphthaleneacetic acid

CAS 1310680-37-5: α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-1-naphthaleneacetic acid

Description:α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-1-naphthaleneacetic acid, commonly referred to as Fmoc-amino acid derivative, is a synthetic compound primarily used in peptide synthesis and drug development. This substance features a naphthaleneacetic acid moiety, which contributes to its hydrophobic characteristics, while the fluorenylmethoxycarbonyl (Fmoc) group serves as a protective group for amino acids during synthesis. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in solid-phase peptide synthesis. The compound exhibits good solubility in organic solvents, which facilitates its use in various chemical reactions. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both aromatic and carboxylic acid functionalities suggests potential for π-π stacking interactions and hydrogen bonding, which can influence its biological activity and binding properties. Overall, this compound is significant in the field of organic chemistry and biochemistry for its utility in synthesizing complex peptides.

Formula:C28H23NO4

InChI:InChI=1S/C28H23NO4/c30-27(31)25(20-15-7-9-18-8-1-2-10-19(18)20)16-29-28(32)33-17-26-23-13-5-3-11-21(23)22-12-4-6-14-24(22)26/h1-15,25-26H,16-17H2,(H,29,32)(H,30,31)

InChI key:InChIKey=WSILPRNTHLWMJU-UHFFFAOYSA-N

SMILES:O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NCC(C(=O)O)C4=CC=CC=5C=CC=CC54

Sort by


See more categories

This search does not contain any category.

Found 3 products.

discount label

1-Naphthaleneacetic acid, α-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]-

CAS:1310680-37-5

Ref: IN-DA000VH4

1gTo inquire
250mg339.00 €
500mg473.00 €
Estimated delivery in United States, on Thursday 27 Mar 2025
discount label

(R,S)-Fmoc-3-amino-2-(naphthalen-1-yl)-propionic acid

CAS:1310680-37-5

Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".