CAS 1311314-95-0: 2-Chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide

Description: 2-Chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, an acetamide functional group, and a trifluoromethyl-substituted phenyl moiety. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its polar and non-polar characteristics due to the presence of both halogen and aromatic groups. The presence of the chloro and trifluoromethyl groups contributes to its potential reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Safety data should be consulted to understand its handling and toxicity profiles, as halogenated compounds can exhibit varied effects on health and the environment.

Formula: C₁₀H₈ClF₄NO

InChI: InChI=1S/C10H8ClF4NO/c11-4-9(17)16-5-6-1-2-7(12)3-8(6)10(13,14)15/h1-3H,4-5H2,(H,16,17)

InChI key: InChIKey=HRGWDZDMRIGQLM-UHFFFAOYSA-N

SMILES: O=C(NCC1=CC=C(F)C=C1C(F)(F)F)CCl

Synonyms:

• 2-Chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide
• Acetamide, 2-chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-

2-Chloro-N-{[4-fluoro-2-(trifluoromethyl)phenyl]methyl}acetamide

CAS: 1311314-95-0

Versatile small molecule scaffold

• Formula: C₁₀H₈ClF₄NO
• Purity: Min. 95%
• Molecular weight: 269.62 g/mol

2-Chloro-n-{[4-fluoro-2-(trifluoromethyl)phenyl]methyl}acetamide

CAS: 1311314-95-0

• Purity: 95%
• Molecular weight: 269.6199951171875