CAS 1311318-08-7: 2-[(Phenylmethyl)thio]propanedial
Description:2-[(Phenylmethyl)thio]propanedial, identified by its CAS number 1311318-08-7, is an organic compound characterized by the presence of a propanedial backbone with a phenylmethylthio group. This compound features a central three-carbon chain with two aldehyde functional groups at each end, which are highly reactive and can participate in various chemical reactions, including oxidation and condensation. The phenylmethylthio substituent introduces a thioether functionality, enhancing the compound's reactivity and potential applications in organic synthesis. The presence of both sulfur and aldehyde groups suggests that this compound may exhibit unique properties, such as increased nucleophilicity and potential for forming stable complexes with metals. Additionally, the aromatic phenyl group contributes to the compound's stability and may influence its solubility and interaction with other molecules. Overall, 2-[(Phenylmethyl)thio]propanedial is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science due to its distinctive structural features.
Formula:C10H10O2S
InChI:InChI=1S/C10H10O2S/c11-6-10(7-12)13-8-9-4-2-1-3-5-9/h1-7,10H,8H2
InChI key:InChIKey=DSMBXUISKUJZGG-UHFFFAOYSA-N
SMILES:O=CC(SCC=1C=CC=CC1)C=O
- Synonyms:
- 2-(Benzylsulfanyl)propanedial
- Propanedial, 2-[(phenylmethyl)thio]-
- 2-Benzylsulfanyl-malonaldehyde
- 2-[(Phenylmethyl)thio]propanedial
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(Benzylsulfanyl)propanedial REF: 3D-LCC31808CAS: 1311318-08-7 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 2-(benzylsulfanyl)-3-hydroxyprop-2-enal REF: 10-F667278CAS: 1311318-08-7 | 95% | - - - | Discontinued product |

2-(Benzylsulfanyl)propanedial
Ref: 3D-LCC31808
50mg | 667.00 € | ||
500mg | 1,863.00 € |

Ref: 10-F667278
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |