CAS 1313712-61-6: 1-(2,2-Diethoxyethoxy)-2-fluorobenzene
Description:1-(2,2-Diethoxyethoxy)-2-fluorobenzene is an organic compound characterized by its unique structure, which includes a fluorobenzene ring substituted with a diethoxyethoxy group. This compound features a fluorine atom attached to the benzene ring, which can influence its reactivity and polarity. The presence of the diethoxyethoxy substituent introduces significant steric bulk and can affect the compound's solubility in various solvents, typically enhancing its solubility in organic solvents due to the ethoxy groups. The compound may exhibit interesting chemical properties, such as potential reactivity in nucleophilic substitution reactions due to the electron-withdrawing nature of the fluorine atom. Additionally, the diethoxyethoxy group can participate in hydrogen bonding, which may influence its physical properties, such as boiling and melting points. Overall, this compound's characteristics make it a subject of interest in organic synthesis and materials science, particularly in applications where specific electronic and steric properties are desired.
Formula:C12H17FO3
InChI:InChI=1S/C12H17FO3/c1-3-14-12(15-4-2)9-16-11-8-6-5-7-10(11)13/h5-8,12H,3-4,9H2,1-2H3
InChI key:InChIKey=QUAGZJIIKHPNPN-UHFFFAOYSA-N
SMILES:FC=1C=CC=CC1OCC(OCC)OCC
- Synonyms:
- Benzene, 1-(2,2-diethoxyethoxy)-2-fluoro-
- 1-(2,2-Diethoxyethoxy)-2-fluorobenzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(2,2-Diethoxyethoxy)-2-fluorobenzene REF: IN-DA00HSFXCAS: 1313712-61-6 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 1-(2,2-diethoxyethoxy)-2-fluorobenzene REF: 54-PC105498CAS: 1313712-61-6 | - - - | To inquire | Fri 28 Mar 25 |
![]() | 1-(2,2-Diethoxyethoxy)-2-fluorobenzene REF: 3D-NCC71261CAS: 1313712-61-6 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 1-(2,2-Diethoxyethoxy)-2-fluorobenzene REF: 10-F640658CAS: 1313712-61-6 | 95+% | - - - | Discontinued product |

Ref: IN-DA00HSFX
Undefined size | To inquire |

1-(2,2-Diethoxyethoxy)-2-fluorobenzene
Ref: 3D-NCC71261
1g | 1,064.00 € | ||
100mg | 461.00 € |

1-(2,2-Diethoxyethoxy)-2-fluorobenzene
Ref: 10-F640658
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |