CAS 1313738-82-7: 1-[1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-pyrrolidinyl]-3-piperidinecarboxylic acid

Description: 1-[1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-pyrrolidinyl]-3-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a fluorenylmethoxycarbonyl (Fmoc) protecting group, a pyrrolidine ring, and a piperidine ring. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to protect amino groups during the synthesis process. The presence of the Fmoc group allows for selective deprotection under mild basic conditions, facilitating the assembly of peptides. The piperidine and pyrrolidine moieties contribute to the compound's potential biological activity, possibly influencing its interaction with various biological targets. Additionally, the carboxylic acid functional group at the end of the molecule enhances its solubility in polar solvents and may play a role in its reactivity and binding properties. Overall, this compound exemplifies the intricate design often required in the development of pharmaceutical agents and research chemicals.

Formula: C₂₅H₂₈N₂O₄

InChI: InChI=1S/C25H28N2O4/c28-24(29)17-6-5-12-26(14-17)18-11-13-27(15-18)25(30)31-16-23-21-9-3-1-7-19(21)20-8-2-4-10-22(20)23/h1-4,7-10,17-18,23H,5-6,11-16H2,(H,28,29)

InChI key: InChIKey=VWTJKXUNEWVTKH-UHFFFAOYSA-N

SMILES: O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)N4CCC(N5CCCC(C(=O)O)C5)C4

1-(1-(((9H-Fluoren-9-yl)Methoxy)carbonyl)pyrrolidin-3-yl)piperidin-3-carboxylic acid

CAS: 1313738-82-7

• Formula: C₂₅H₂₈N₂O₄
• Molecular weight: 420.5008

1-(1-(((9H-fluoren-9-yl)methoxy)carbonyl)pyrrolidin-3-yl)piperidine-3-carboxylic acid

CAS: 1313738-82-7

• Purity: 98%
• Molecular weight: 420.5090026855469