CAS 13138-53-9: 4-Nitro-1,2-benzenedicarboxamide

Description:4-Nitro-1,2-benzenedicarboxamide, also known as 4-nitrophthalic acid diamide, is an organic compound characterized by its aromatic structure featuring two carboxamide groups and a nitro substituent. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity and solubility. This compound typically appears as a crystalline solid and is soluble in polar solvents due to its ability to form hydrogen bonds. Its molecular structure allows for potential applications in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. The compound's stability is generally good under standard conditions, but it may be sensitive to strong oxidizing agents. Additionally, safety precautions should be taken when handling this substance, as nitro compounds can be hazardous and may pose environmental risks. Overall, 4-Nitro-1,2-benzenedicarboxamide is a notable compound in organic chemistry with diverse applications and implications.

Formula:C₈H₇N₃O₄

InChI:InChI=1S/C8H7N3O4/c9-7(12)5-2-1-4(11(14)15)3-6(5)8(10)13/h1-3H,(H2,9,12)(H2,10,13)

InChI key:InChIKey=XWCDSCYRIROFIO-UHFFFAOYSA-N

SMILES:O=C(N)C1=CC=C(C=C1C(=O)N)N(=O)=O

Synonyms:
1,2-Benzenedicarboxamide, 4-nitro-
4-Nitro-1,2-benzenedicarboxamide
4-Nitrobenzene-1,2-Dicarboxamide
4-Nitrophthaldiamide
NSC 94821
Nitrophthalamide
4-Nitrophthalamide

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1,2-Benzenedicarboxamide, 4-nitro- REF: IN-DA000W2QCAS: 13138-53-9	97%	25.00 €~152.00 €	Thu 27 Mar 25
4-Nitrophthalamide REF: 54-OR80230CAS: 13138-53-9	98%	32.00 €~929.00 €	Fri 28 Mar 25
4-Nitrophthalamide REF: 7W-GT9955CAS: 13138-53-9	- - -	To inquire	Fri 28 Mar 25
4-Nitrophthalamide REF: 10-F219761CAS: 13138-53-9	95.0%	To inquire	Tue 08 Apr 25
4-nitrophthalamide REF: 3D-FN59325CAS: 13138-53-9	Min. 95%	- - -	Discontinued product