CAS 131436-22-1: (9aS)-8-Acetyl-9,9a-dihydro-1,3,7-trihydroxy-9a-methyl-9-oxo-4-dibenzofurancarboxamide
Description:The chemical substance known as (9aS)-8-Acetyl-9,9a-dihydro-1,3,7-trihydroxy-9a-methyl-9-oxo-4-dibenzofurancarboxamide, with the CAS number 131436-22-1, is a complex organic compound characterized by its unique structural features, including multiple hydroxyl groups and a dibenzofuran moiety. This compound exhibits a specific stereochemistry, indicated by the (9aS) designation, which influences its biological activity and interactions. The presence of acetyl and carboxamide functional groups suggests potential reactivity and solubility in various solvents, making it of interest in medicinal chemistry and pharmacology. Its hydroxyl groups may contribute to hydrogen bonding capabilities, affecting its solubility and interaction with biological targets. Additionally, the compound's oxo and methyl substituents can influence its electronic properties and stability. Overall, this substance may have applications in drug development or as a biochemical probe, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C16H13NO7
InChI:InChI=1S/C16H13NO7/c1-5(18)10-7(20)4-9-16(2,14(10)22)12-8(21)3-6(19)11(15(17)23)13(12)24-9/h3-4,19-21H,1-2H3,(H2,17,23)/t16-/m1/s1
InChI key:InChIKey=GEWLYFZWVLXQME-MRXNPFEDSA-N
SMILES:O=C(N)C1=C(O)C=C(O)C2=C1OC3=CC(O)=C(C(=O)C)C(=O)C32C
- Synonyms:
- (9aS)-8-Acetyl-9,9a-dihydro-1,3,7-trihydroxy-9a-methyl-9-oxo-4-dibenzofurancarboxamide
- (9aS)-8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxo-9,9a-dihydrodibenzo[b,d]furan-4-carboxamide
- 4-Dibenzofurancarboxamide, 8-acetyl-9,9a-dihydro-1,3,7-trihydroxy-9a-methyl-9-oxo-, (9aS)-
- 4-Dibenzofurancarboxamide, 8-acetyl-9,9a-dihydro-1,3,7-trihydroxy-9a-methyl-9-oxo-, (S)-
- (-)-Cercosporamide
- Cercosporamide