CAS 131474-38-9: D-LUCIFERIN-6-O-BETA-D-GALACTOPYRANOSIDE
Description:D-Luciferin-6-O-beta-D-galactopyranoside is a chemical compound that serves as a substrate for luciferase enzymes, which are involved in bioluminescence. This compound is a derivative of D-luciferin, characterized by the addition of a galactopyranoside moiety at the 6-position. It is typically used in biochemical assays and research applications to study enzyme activity and cellular processes. The presence of the galactopyranoside group enhances its solubility and stability in biological systems, making it a useful tool in molecular biology. D-Luciferin itself is known for its ability to emit light upon oxidation, a property that is harnessed in various imaging and detection techniques. The compound is generally stable under standard laboratory conditions but should be handled with care to avoid degradation. Its applications extend to areas such as drug discovery, gene expression studies, and the development of biosensors. Overall, D-Luciferin-6-O-beta-D-galactopyranoside is a valuable compound in the field of biochemistry and molecular biology.
Formula:C17H18N2O8S2
InChI:InChI=1/C17H18N2O8S2/c20-4-9-11(21)12(22)13(23)17(27-9)26-6-1-2-7-10(3-6)29-15(18-7)14-19-8(5-28-14)16(24)25/h1-3,8-9,11-13,17,20-23H,4-5H2,(H,24,25)/t8-,9-,11+,12+,13-,17-/m1/s1
- Synonyms:
- D-Luciferin-60-beta-D-Galactopyranoside
- luciferin-O-galactopyranoside
- (4S)-2-[6-(beta-D-galactopyranosyloxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid