CAS 1314985-53-9: 5-Bromo-1-(1,1-dimethylethyl)-6-propoxy-1H-benzimidazole
Description:5-Bromo-1-(1,1-dimethylethyl)-6-propoxy-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a bromine atom and a propoxy group. The presence of the bulky tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to the presence of the benzimidazole moiety, which is known for its applications in medicinal chemistry, particularly as an anti-parasitic and anti-cancer agent. The bromine substitution can also affect the electronic properties of the molecule, potentially enhancing its reactivity or interaction with biological targets. Additionally, the propoxy group may contribute to the compound's overall hydrophobic character, impacting its distribution in biological systems. Overall, 5-Bromo-1-(1,1-dimethylethyl)-6-propoxy-1H-benzimidazole represents a unique structure that may be of interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H19BrN2O
InChI:InChI=1S/C14H19BrN2O/c1-5-6-18-13-8-12-11(7-10(13)15)16-9-17(12)14(2,3)4/h7-9H,5-6H2,1-4H3
InChI key:InChIKey=IAJJHJVNODDTOT-UHFFFAOYSA-N
SMILES:BrC1=CC=2N=CN(C2C=C1OCCC)C(C)(C)C
- Synonyms:
- 5-Bromo-1-(1,1-dimethylethyl)-6-propoxy-1H-benzimidazole
- 1H-Benzimidazole, 5-bromo-1-(1,1-dimethylethyl)-6-propoxy-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Benzimidazole, 5-bromo-1-(1,1-dimethylethyl)-6-propoxy- REF: IN-DA000WC6CAS: 1314985-53-9 | - - - | To inquire | Thu 27 Mar 25 |
 | 5-Bromo-1-(tert-butyl)-6-propoxy-1H-benzo[d]imidazole REF: 10-F213258CAS: 1314985-53-9 | 95.0% | - - - | Discontinued product |
 | 5-Bromo-1-t-butyl-6-propoxybenzimidazole REF: 3D-PCC98553CAS: 1314985-53-9 | Min. 95% | - - - | Discontinued product |
1H-Benzimidazole, 5-bromo-1-(1,1-dimethylethyl)-6-propoxy-
Ref: IN-DA000WC6
| Undefined size | To inquire |
![5-Bromo-1-(tert-butyl)-6-propoxy-1H-benzo[d]imidazole](https://static.cymitquimica.com/products/10/thumb/F213258.jpg)
5-Bromo-1-(tert-butyl)-6-propoxy-1H-benzo[d]imidazole
Ref: 10-F213258
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
5-Bromo-1-t-butyl-6-propoxybenzimidazole
Ref: 3D-PCC98553
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
