CAS 131747-36-9: ACETIC ACID 2-CYANO-PYRIDIN-3-YLMETHYL ESTER

Description:Acetic acid 2-cyano-pyridin-3-ylmethyl ester, with the CAS number 131747-36-9, is an organic compound characterized by its ester functional group, which is derived from acetic acid and a pyridine derivative. This compound typically exhibits a polar nature due to the presence of both the carboxylate and cyano groups, which can influence its solubility in various solvents, often making it soluble in polar organic solvents. The pyridine ring contributes to its aromatic character, potentially affecting its reactivity and stability. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, owing to the functional groups that can participate in various chemical reactions. Additionally, the presence of the cyano group may impart specific electronic properties, making it a candidate for further functionalization or as an intermediate in chemical synthesis. Safety data should be consulted for handling and storage, as esters can vary in toxicity and reactivity.

Formula:C₉H₈N₂O₂

InChI:InChI=1/C9H8N2O2/c1-7(12)13-6-8-3-2-4-11-9(8)5-10/h2-4H,6H2,1H3

Synonyms:
(2-Cyanopyridin-3-yl)methyl acetate
2-Pyridinecarbonitrile, 3-[(Acetyloxy)Methyl]-
(2-Cyano-3-Pyridyl)Methyl Acetate
Acetic acid 2-cyano-pyridin-3-ylmethyl ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-Pyridinecarbonitrile, 3-[(acetyloxy)methyl]- REF: IN-DA000ZNECAS: 131747-36-9	- - -	To inquire	Thu 27 Mar 25
(2-Cyanopyridin-3-yl)methyl acetate REF: 10-F768405CAS: 131747-36-9	98%	- - -	Discontinued product
(2-Cyanopyridin-3-yl)methyl acetate REF: 3D-GFA74736CAS: 131747-36-9	Min. 95%	- - -	Discontinued product