CAS 131774-72-6: 3-Hydrazinylbenzenesulfonamide

Description:3-Hydrazinylbenzenesulfonamide, with the CAS number 131774-72-6, is an organic compound characterized by the presence of a hydrazine functional group attached to a benzenesulfonamide moiety. This compound typically exhibits properties associated with both hydrazines and sulfonamides, including potential reactivity due to the hydrazine nitrogen atoms, which can participate in various chemical reactions, such as condensation and oxidation. The sulfonamide group contributes to its solubility in polar solvents and may impart biological activity, as sulfonamides are known for their antimicrobial properties. The compound may also exhibit moderate to high melting points and stability under standard conditions, although specific thermal and solubility characteristics can vary. Additionally, 3-Hydrazinylbenzenesulfonamide may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the synthesis of biologically active molecules. As with many hydrazine derivatives, caution is advised due to potential toxicity and reactivity.

Formula:C₆H₉N₃O₂S

InChI:InChI=1S/C6H9N3O2S/c7-9-5-2-1-3-6(4-5)12(8,10)11/h1-4,9H,7H2,(H2,8,10,11)

InChI key:InChIKey=QWQDXEPJHSJIQN-UHFFFAOYSA-N

SMILES:O=S(=O)(N)C=1C=CC=C(C1)NN

Synonyms:
3-Hydrazino Benzenesulfonamide
3-Hydrazino-benzenesulfonicacidamide
3-Hydrazinylbenzene-1-sulfonamide
3-Hydrazinylbenzenesulfonamide
Benzenesulfonamide, 3-Hydrazino-
Benzenesulfonamide, 3-hydrazino- (9CI)
Benzenesulfonamide, 3-hydrazinyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzenesulfonamide, 3-hydrazinyl- REF: IN-DA000ZQECAS: 131774-72-6	96%	70.00 €~578.00 €	Mon 10 Mar 25
3-Hydrazinobenzenesulfonamide REF: 10-F068169CAS: 131774-72-6	97.0%	To inquire	Thu 20 Mar 25
Benzenesulfonamide,3-hydrazino- REF: 3D-FB149925CAS: 131774-72-6	Min. 95%	107.00 €~1,252.00 €	Mon 19 May 25