CAS 131852-54-5: (S)-3-AMINO-1-BENZYLPYRROLIDINE DIHYDROCHLORIDE
Description:(S)-3-Amino-1-benzylpyrrolidine dihydrochloride is a chiral organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of the amino group at the 3-position and the benzyl substituent contributes to its unique properties, including potential biological activity. This compound is typically encountered as a dihydrochloride salt, enhancing its solubility in polar solvents, which is advantageous for various applications in medicinal chemistry and drug development. The stereochemistry indicated by the (S) designation suggests that it has specific spatial arrangements that may influence its interaction with biological targets, making it of interest in pharmacological studies. Its CAS number, 131852-54-5, allows for precise identification in chemical databases. Overall, (S)-3-amino-1-benzylpyrrolidine dihydrochloride is notable for its structural features and potential utility in research related to neuropharmacology and other fields.
Formula:C11H18Cl2N2
InChI:InChI=1/C11H16N2.2ClH/c12-11-6-7-13(9-11)8-10-4-2-1-3-5-10;;/h1-5,11H,6-9,12H2;2*1H/t11-;;/m0../s1
- Synonyms:
- (S)-1-Benzyl-3-aminopyrrolidine dihydrochloride
- (S)-3-Amino-1-benzylpyrrolidine2HCl
- (S)-1-Benxyl-3-Amino-Pyrrolidine2Hcl
- (S)-1-Benzyl-pyrrolidine-3-amine dihydrochloride
- (3S)-1-benzylpyrrolidin-3-amine dihydrochloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Pyrrolidinamine, 1-(phenylmethyl)-, hydrochloride (1:2), (3S)- REF: IN-DA000ZUBCAS: 131852-54-5 | 97% | 48.00 €~262.00 € | Thu 27 Mar 25 |
 | (S)-3-Amino-1-N-benzylpyrrolidine dihydrochloride REF: 10-F094024CAS: 131852-54-5 | 95.0% | To inquire | Tue 08 Apr 25 |
 | (S)-3-Amino-1-benzylpyrrolidinedihydrochloride REF: 3D-FA149103CAS: 131852-54-5 | Min. 95% | - - - | Discontinued product |
3-Pyrrolidinamine, 1-(phenylmethyl)-, hydrochloride (1:2), (3S)-
Ref: IN-DA000ZUB
| 5g | 114.00 € |
(S)-3-Amino-1-N-benzylpyrrolidine dihydrochloride
Ref: 10-F094024
| 1g | To inquire | ||
| 5g | To inquire | ||
| 25g | To inquire |
(S)-3-Amino-1-benzylpyrrolidinedihydrochloride
Ref: 3D-FA149103
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information |
