CAS 132034-89-0: 4-Iododibenzothiophene

Description:4-Iododibenzothiophene is an organic compound characterized by the presence of both iodine and a dibenzothiophene structure, which consists of a sulfur atom integrated into a fused aromatic ring system. This compound typically exhibits a high degree of stability due to the aromatic nature of its structure, making it relatively resistant to oxidation and other chemical reactions. The iodine substituent can influence its electronic properties, potentially enhancing its reactivity in certain chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of sulfur in the dibenzothiophene framework may impart unique properties, such as increased solubility in organic solvents and potential applications in materials science, particularly in organic electronics and photonic devices. The compound's molecular structure allows for various functionalization possibilities, making it a valuable intermediate in synthetic organic chemistry. Overall, 4-Iododibenzothiophene is of interest in both academic research and industrial applications due to its distinctive chemical properties and potential utility in advanced materials.

Formula:C₁₂H₇IS

InChI:InChI=1S/C12H7IS/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H

Synonyms:
4-Iododibenzo[b,d]thiophene
Dibenzo[B,D]Thiophene, 4-Iodo-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Iododibenzothiophene REF: 3B-I0947CAS: 132034-89-0	>98.0%(GC)	58.00 €~180.00 €	Thu 20 Mar 25
Dibenzothiophene, 4-iodo- REF: IN-DA00103DCAS: 132034-89-0	98%	26.00 €~196.00 €	Thu 27 Mar 25
4-Iododibenzo[b,d]thiophene REF: 54-OR74707CAS: 132034-89-0	98+%	32.00 €~1,432.00 €	Fri 28 Mar 25
4-Iododibenzo[b,d]thiophene REF: 10-F334811CAS: 132034-89-0	95.0%	To inquire	Tue 08 Apr 25
4-Iododibenzothiophene REF: 3D-HFA03489CAS: 132034-89-0	Min. 95%	172.00 €~1,113.00 €	Thu 22 May 25