CAS 132413-50-4: 2,3,4,6-tetra-O-benzoyl-beta-D-glucopy-ranosyl isothiocyan.
Description:2,3,4,6-Tetra-O-benzoyl-beta-D-glucopyranosyl isothiocyanate is a glycosyl isothiocyanate derivative, characterized by the presence of a glucopyranosyl moiety with four benzoyl protecting groups. This compound features a beta configuration at the anomeric carbon, which influences its reactivity and solubility. The isothiocyanate functional group is known for its biological activity, including potential anticancer properties and its role in the synthesis of various bioactive compounds. The presence of multiple benzoyl groups enhances the lipophilicity of the molecule, which can affect its interaction with biological membranes and its overall pharmacokinetics. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its stability and reactivity can be influenced by the conditions under which it is handled, including temperature and the presence of nucleophiles. Overall, 2,3,4,6-tetra-O-benzoyl-beta-D-glucopyranosyl isothiocyanate is a significant compound in the field of medicinal chemistry and glycoscience.
Formula:C35H27NO9S
InChI:InChI=1/C35H27NO9S/c37-32(23-13-5-1-6-14-23)41-21-27-28(43-33(38)24-15-7-2-8-16-24)29(44-34(39)25-17-9-3-10-18-25)30(31(42-27)36-22-46)45-35(40)26-19-11-4-12-20-26/h1-20,27-31H,21H2/t27-,28-,29+,30-,31-/m1/s1
- Synonyms:
- 2,3,4,6-Tetra-O-benzoyl--D-glucopyranosyl isothiocyanate
- 2,3,4,6-tetra-O-benzoyl-N-(thioxomethylidene)-beta-D-glucopyranosylamine

β-D-Glucopyranosyl isothiocyanate, 2,3,4,6-tetrabenzoate
Ref: IN-DA0010NX
100mg | 568.00 € |

2,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl isothiocyanate
Ref: 3D-MT05028
50mg | 344.00 € | ||
100mg | 410.00 € | ||
250mg | 794.00 € |

2,3,4,6-Tetra-O-benzoyl-ß-D-glucopyranosyl isothiocyanate
Ref: 10-F050975
1g | Discontinued | Request information |