CAS 132464-84-7: 2,3-Dihydro-5-iodobenzofuran

Description:2,3-Dihydro-5-iodobenzofuran is an organic compound characterized by its unique bicyclic structure, which consists of a benzofuran moiety with a dihydro configuration and an iodine substituent at the 5-position. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both carbon and hydrogen atoms along with iodine. It is generally a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the iodine atom can impart specific reactivity, making it useful in various chemical synthesis applications, particularly in medicinal chemistry and organic synthesis. The compound may exhibit moderate solubility in organic solvents, while its reactivity can be influenced by the electron-withdrawing nature of the iodine substituent. Additionally, 2,3-Dihydro-5-iodobenzofuran may participate in electrophilic aromatic substitution reactions, and its derivatives can serve as intermediates in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as iodine-containing compounds can pose health risks.

Formula:C₈H₇IO

InChI:InChI=1S/C8H7IO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5H,3-4H2

InChI key:InChIKey=BSLVNOLUEJOXMR-UHFFFAOYSA-N

SMILES:IC1=CC=C2OCCC2=C1

Synonyms:
2,3-Dihydro-5-Iodobenzo[B]Furan
2,3-Dihydro-5-iodobenzofuran
5-Iodo-2,3-Dihydro-1-Benzofuran
5-Iodo-2,3-Dihydrobenzofuran
Benzofuran, 2,3-dihydro-5-iodo-
Buttpark 36\18-19

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzofuran, 2,3-dihydro-5-iodo- REF: IN-DA0010P5CAS: 132464-84-7	98%	41.00 €~495.00 €	Thu 27 Mar 25
2,3-Dihydro-5-iodobenzo[b]furan REF: 54-OR0381CAS: 132464-84-7	95+%	80.00 €~175.00 €	Fri 28 Mar 25
5-Iodo-2,3-dihydrobenzo[b]furan REF: 10-F017491CAS: 132464-84-7	99.0%	To inquire	Tue 08 Apr 25
5-Iodo-2,3-dihydrobenzofuran REF: 3D-HFA46484CAS: 132464-84-7	Min. 95%	To inquire	Thu 08 May 25