CAS 132741-31-2: 3,5-difluoromandelic acid
Description:3,5-Difluoromandelic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms at the 3 and 5 positions of the mandelic acid structure. This compound features a phenyl group attached to a carbon bearing both a hydroxyl (-OH) and a carboxylic acid (-COOH) functional group, contributing to its acidic properties. The introduction of fluorine atoms enhances the compound's polarity and can influence its reactivity and solubility in various solvents. Typically, such fluorinated compounds exhibit increased stability and altered biological activity compared to their non-fluorinated counterparts. 3,5-Difluoromandelic acid may be utilized in organic synthesis and pharmaceutical applications, particularly in the development of fluorinated drugs or as intermediates in chemical reactions. Its unique structural features make it a subject of interest in medicinal chemistry and materials science. As with many fluorinated compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.
Formula:C8H5F2O3
InChI:InChI=1S/C8H6F2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7,11H,(H,12,13)
InChI key:InChIKey=PHMLPPFFMSRWBK-UHFFFAOYSA-N
SMILES:O=C(O)C(O)C=1C=C(F)C=C(F)C1
- Synonyms:
- (2R)-(3,5-difluorophenyl)(hydroxy)ethanoate
- (2S)-(3,5-difluorophenyl)(hydroxy)ethanoate
- (3,5-Difluorophenyl)(Hydroxy)Acetic Acid
- 2-(3,5-Difluorophenyl)-2-hydroxyacetic acid
- 3,5-Difluoro-α-hydroxybenzeneacetic acid
- Benzeneacetic acid, 3,5-difluoro-α-hydroxy-
- alpha-Hydroxy-3,5-difluorophenylacetic acid
Benzeneacetic acid, 3,5-difluoro-α-hydroxy-
Ref: IN-DA00113S
| 1g | 29.00 € | ||
| 5g | 76.00 € | ||
| 25g | 212.00 € | ||
| 100g | To inquire | ||
| 250mg | 21.00 € |
Ref: 10-F004826
| 1g | 23.00 € | ||
| 5g | 82.00 € |
3,5-Difluoromandelic acid
Ref: 54-PC2842G
| 5g | 86.00 € | ||
| 25g | 288.00 € |
3,5-Difluoromandelic acid
Ref: 3D-FD37082
| 1g | 336.00 € | ||
| 2g | 487.00 € | ||
| 5g | 648.00 € |
