
CAS 1332530-89-8: Proline, 2-ethyl-, hydrochloride (1:1)
Description:Proline, 2-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its structure as a derivative of proline, an amino acid that plays a crucial role in protein synthesis. This specific compound features an ethyl group substitution at the second carbon of the proline backbone, which influences its physical and chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and biochemistry. The presence of the hydrochloride indicates that it can exist as a stable crystalline solid, often exhibiting hygroscopic behavior. Proline derivatives are known for their role in stabilizing protein structures and may also exhibit unique biological activities. The compound's CAS number, 1332530-89-8, allows for precise identification and differentiation from other substances in chemical databases. Overall, 2-ethyl proline hydrochloride is of interest in research and development, particularly in the fields of medicinal chemistry and biochemistry.
Formula:C7H13NO2·ClH
InChI:InChI=1S/C7H13NO2.ClH/c1-2-7(6(9)10)4-3-5-8-7;/h8H,2-5H2,1H3,(H,9,10);1H
InChI key:InChIKey=GSRIGVRKLONTDM-UHFFFAOYSA-N
SMILES:Cl.O=C(O)C1(NCCC1)CC
- Synonyms:
- Proline, 2-ethyl-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-ethylproline hydrochloride REF: 10-F360443CAS: 1332530-89-8 | 98% | - - - | Discontinued product |
![]() | 2-Ethylproline hydrochloride REF: 3D-FE125420CAS: 1332530-89-8 | Min. 95% | - - - | Discontinued product |

2-ethylproline hydrochloride
Ref: 10-F360443
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
500mg | Discontinued | Request information |

2-Ethylproline hydrochloride
Ref: 3D-FE125420
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |