CAS 133284-74-9: Ethyl 4-(8-chloro-6,11-dihydro-11-hydroxy-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-yl)-1-piperidinecarboxylate
Description:Ethyl 4-(8-chloro-6,11-dihydro-11-hydroxy-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-yl)-1-piperidinecarboxylate, with CAS number 133284-74-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzo[c]cycloheptane moiety. This compound features a chloro substituent and a hydroxyl group, contributing to its potential biological activity. It is typically classified as an organic compound and may exhibit properties such as solubility in organic solvents, depending on its specific functional groups. The presence of the piperidine and the bicyclic structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity and reactivity. Further studies would be necessary to elucidate its pharmacological properties and applications.
Formula:C22H25ClN2O3
InChI:InChI=1S/C22H25ClN2O3/c1-2-28-21(26)25-12-9-17(10-13-25)22(27)19-8-7-18(23)14-16(19)6-5-15-4-3-11-24-20(15)22/h3-4,7-8,11,14,17,27H,2,5-6,9-10,12-13H2,1H3
InChI key:InChIKey=WVWGYTXDYNKXEY-UHFFFAOYSA-N
SMILES:O=C(OCC)N1CCC(CC1)C2(O)C3=NC=CC=C3CCC4=CC(Cl)=CC=C42
- Synonyms:
- 5H-Benzo[5,6]cyclohepta[1,2-b]pyridine, 1-piperidinecarboxylic acid deriv.
- Ethyl 4-(8-chloro-6,11-dihydro-11-hydroxy-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-yl)-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-(8-chloro-6,11-dihydro-11-hydroxy-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-yl)-, ethyl ester