CAS 133310-19-7: 3,5-Diamino-6-(2,3-dichlorophenyl)-2-β-D-glucopyranuronosyl-1,2,4-triazinium
Description:3,5-Diamino-6-(2,3-dichlorophenyl)-2-β-D-glucopyranuronosyl-1,2,4-triazinium is a complex organic compound characterized by its unique structural features, including multiple functional groups and a triazinium moiety. The presence of amino groups suggests potential for hydrogen bonding and reactivity, while the dichlorophenyl group may impart specific electronic properties and hydrophobic characteristics. The glucopyranuronosyl component indicates that the compound is derived from a sugar, which can influence its solubility and biological interactions. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for research in medicinal chemistry. Its CAS number, 133310-19-7, allows for precise identification in chemical databases. Overall, the combination of amino, triazine, and sugar components suggests potential applications in drug development, particularly in targeting specific biological pathways or as a scaffold for further chemical modifications. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential applications.
Formula:C15H16Cl2N5O6
InChI:InChI=1S/C15H15Cl2N5O6/c16-5-3-1-2-4(6(5)17)7-12(18)20-15(19)22(21-7)13-10(25)8(23)9(24)11(28-13)14(26)27/h1-3,8-11,13,23-25H,(H4,18,19,20,26,27)/p+1/t8-,9-,10+,11-,13+/m0/s1
InChI key:InChIKey=IEVMENHZPOWVGO-XPORZQOISA-O
SMILES:O=C(O)C1OC([N+]=2N=C(C(=NC2N)N)C=3C=CC=C(Cl)C3Cl)C(O)C(O)C1O
- Synonyms:
- 1,2,4-Triazinium, 3,5-diamino-6-(2,3-dichlorophenyl)-2-β-<span class="text-smallcaps">D</span>-glucopyranuronosyl-
- 3,5-Diamino-6-(2,3-dichlorophenyl)-2-D-glucopyranuronosyl-1,2,4-triaziniu
- 3,5-Diamino-6-(2,3-dichlorophenyl)-2-D-glucopyranuronosyl-1,2,4-triazinium
- 3,5-Diamino-6-(2,3-dichlorophenyl)-2-β-<span class="text-smallcaps">D</span>-glucopyranuronosyl-1,2,4-triazinium
- 3,5-diamino-6-(2,3-dichlorophenyl)-2-(beta-D-glucopyranuronosyl)-1,2,4-triazin-2-ium
- Lamotrigine N<sup>2</sup>-glucuronide
- LamotrigineN2-glucuronide
- lamotrigine 2-N-glucuronide
- 3,5-Diamino-6-(2,3-dichlorophenyl)-2-β-D-glucopyranuronosyl-1,2,4-triazinium
- Lamotrigine N2-glucuronide
- See more synonyms
- 1,2,4-Triazinium, 3,5-diamino-6-(2,3-dichlorophenyl)-2-β-D-glucopyranuronosyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Lamotrigine N2-glucuronide REF: 7W-GC0841CAS: 133310-19-7 | ≥ 95.0% | To inquire | Fri 28 Mar 25 |

Lamotrigine N2-glucuronide
Ref: 7W-GC0841
Undefined size | To inquire |