CAS 133438-58-1: (4-Methyl-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]methanone

Description:The chemical substance known as (4-Methyl-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]methanone, with the CAS number 133438-58-1, is a complex organic compound characterized by its multi-ring structure and functional groups. It features a naphthalene moiety substituted with a methyl group, which contributes to its hydrophobic properties. The indole ring system is significant for its biological activity, often associated with various pharmacological effects. The presence of a morpholine group indicates potential interactions with biological targets, enhancing its solubility and reactivity. This compound may exhibit properties such as fluorescence or photostability, making it of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. Understanding its chemical behavior, including reactivity and stability under various conditions, is crucial for applications in research and industry.

Formula:C₂₆H₂₆N₂O₂

InChI:InChI=1S/C26H26N2O2/c1-19-10-11-23(21-7-3-2-6-20(19)21)26(29)24-18-28(25-9-5-4-8-22(24)25)13-12-27-14-16-30-17-15-27/h2-11,18H,12-17H2,1H3

InChI key:InChIKey=ICKWPPYMDARCKJ-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(C=2C=CC=CC12)C)C3=CN(C=4C=CC=CC34)CCN5CCOCC5