CAS 13389-03-2: 8-BROMO-2'-DEOXYGUANOSINE
Description:8-Bromo-2'-deoxyguanosine is a modified nucleoside that serves as an important tool in molecular biology and biochemistry. It is a derivative of deoxyguanosine, where a bromine atom is substituted at the 8-position of the purine ring. This modification can influence the nucleoside's base-pairing properties and its incorporation into DNA, making it useful for studying DNA replication and repair mechanisms. The presence of the bromine atom can also enhance the compound's reactivity, allowing it to participate in various chemical reactions, including those involved in the formation of DNA adducts. 8-Bromo-2'-deoxyguanosine is often used in research to investigate the effects of oxidative stress and the role of modified nucleotides in mutagenesis. Its CAS number, 13389-03-2, is a unique identifier that facilitates the cataloging and retrieval of information related to this compound in chemical databases. Overall, this nucleoside plays a significant role in understanding the biochemical pathways and interactions within cellular systems.
Formula:C10H12BrN5O4
InChI:InChI=1S/C10H12BrN5O4/c11-9-13-6-7(14-10(12)15-8(6)19)16(9)5-1-3(18)4(2-17)20-5/h3-5,17-18H,1-2H2,(H3,12,14,15,19)/t3-,4+,5+/m0/s1
InChI key:InChIKey=MKDXZFVCXWXGBQ-VPENINKCSA-N
SMILES:O=C1N=C(N)NC2=C1N=C(Br)N2C3OC(CO)C(O)C3
- Synonyms:
- 2-amino-8-bromo-9-(2-deoxypentofuranosyl)-3,9-dihydro-6H-purin-6-one
- 8-Bromo-2'-deoxy-D-guanosine
- Guanosine, 8-bromo-2′-deoxy-
- NSC 105830
- 8-Bromo-2′-deoxyguanosine
