CAS 13423-73-9: 4-Hydroxy-3,5-bis(1-methylethyl)benzoic acid
Description:4-Hydroxy-3,5-bis(1-methylethyl)benzoic acid, also known as a derivative of benzoic acid, is characterized by its aromatic structure featuring a hydroxyl group and two isopropyl groups attached to the benzene ring. This compound exhibits properties typical of phenolic acids, including potential antioxidant activity due to the presence of the hydroxyl group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic isopropyl substituents. The presence of the carboxylic acid functional group contributes to its acidity, allowing it to participate in various chemical reactions, such as esterification and salt formation. Additionally, this compound may have applications in the fields of pharmaceuticals, agrochemicals, or as a chemical intermediate, owing to its structural features that can influence biological activity. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H18O3
InChI:InChI=1S/C13H18O3/c1-7(2)10-5-9(13(15)16)6-11(8(3)4)12(10)14/h5-8,14H,1-4H3,(H,15,16)
InChI key:InChIKey=WYAZPCLFZZTVSP-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C(O)=C(C1)C(C)C)C(C)C
- Synonyms:
- Benzoic acid, 4-hydroxy-3,5-bis(1-methylethyl)-
- 4-Hydroxy-3,5-diisopropylbenzoic acid
- 4-Hydroxy-3,5-bis(1-methylethyl)benzoic acid
- 3,5-Diisopropyl-4-hydroxybenzoic acid
- Benzoic acid, 4-hydroxy-3,5-diisopropyl-
