CAS 134457-14-0: 4,4'-bis(bromomethyl)-2,2'-bipyridine

Description:4,4'-Bis(bromomethyl)-2,2'-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a central carbon atom. This compound features two bromomethyl groups (-CH2Br) attached to the 4-position of each pyridine ring, enhancing its reactivity and potential applications in various chemical reactions, particularly in coordination chemistry. The presence of bromine atoms makes it a suitable candidate for nucleophilic substitution reactions, allowing for the introduction of various functional groups. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows it to act as a ligand in metal coordination complexes, which can be utilized in catalysis and materials science. Additionally, the bromomethyl groups can facilitate further functionalization, making it a versatile building block in organic synthesis. Safety precautions should be taken when handling this compound due to the presence of bromine, which can be hazardous.

Formula:C₁₂H₁₀Br₂N₂

InChI:InChI=1/C12H10Br2N2/c13-7-9-1-3-15-11(5-9)12-6-10(8-14)2-4-16-12/h1-6H,7-8H2

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4,4'-bis(bromomethyl)-2,2'-bipyridine REF: IN-DA00392VCAS: 134457-14-0	97%	46.00 €~240.00 €	Thu 27 Mar 25
4,4'-Bis(bromomethyl)-2,2'-bipyridine REF: 54-OR91218CAS: 134457-14-0	98+%	32.00 €~1,319.00 €	Fri 28 Mar 25
4,4'-Bis(bromomethyl)-2,2'-bipyridine REF: 10-F232924CAS: 134457-14-0	95.0%	34.00 €~417.00 €	Tue 01 Apr 25
4,4'-Bis(bromomethyl)-2,2'-bipyridine REF: 3D-W-201124CAS: 134457-14-0	Min. 95 Area-%	To inquire	Mon 07 Apr 25
4,4'-Bis(bromomethyl)-2,2'-bipyridine REF: 3D-FB15034CAS: 134457-14-0	Min. 95%	326.00 €~1,457.00 €	Mon 07 Apr 25