CAS 134612-84-3: (4-Chlorophenyl)(3,4-dihydroxyphenyl)methanone

Description:(4-Chlorophenyl)(3,4-dihydroxyphenyl)methanone, with the CAS number 134612-84-3, is an organic compound characterized by its complex aromatic structure. It features a chlorinated phenyl group and a methanone functional group, which contributes to its reactivity and potential applications in various chemical processes. The presence of hydroxyl groups on the phenyl ring enhances its solubility in polar solvents and may influence its biological activity, making it of interest in pharmaceutical research. This compound is likely to exhibit properties typical of ketones, such as being a potential electrophile in nucleophilic addition reactions. Additionally, the chlorophenyl moiety may impart unique electronic properties, affecting its interaction with other molecules. Its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound's unique functional groups and structural features suggest potential utility in medicinal chemistry and materials science.

Formula:C₁₃H₉ClO₃

InChI:InChI=1S/C13H9ClO3/c14-10-4-1-8(2-5-10)13(17)9-3-6-11(15)12(16)7-9/h1-7,15-16H

InChI key:InChIKey=SYNNFRPIIUNOHK-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(Cl)C=C1)C2=CC=C(O)C(O)=C2

Synonyms:
(4-Chlorophenyl)(3,4-dihydroxyphenyl)methanone
Methanone, (4-Chlorophenyl)(3,4-Dihydroxyphenyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(4-Chlorophenyl)(3,4-dihydroxyphenyl)methanone REF: IN-DA0070CQCAS: 134612-84-3	95%	26.00 €~224.00 €	Thu 27 Mar 25
Fenofibrate Impurity 11 REF: 4Z-F-0223CAS: 134612-84-3	- - -	To inquire	Thu 03 Apr 25
(4-Chlorophenyl)(3,4-dihydroxyphenyl)methanone REF: 10-F241267CAS: 134612-84-3	95.0%	To inquire	Tue 08 Apr 25
4-Chloro-3,4-dihydroxybenzophenone REF: 3D-JFA61284CAS: 134612-84-3	Min. 95%	- - -	Discontinued product