CAS 134676-49-6: Piperazinone, 3-(phenylmethyl)-, (S)- (9CI)
Description:Piperazinone, 3-(phenylmethyl)-, (S)- (9CI), with the CAS number 134676-49-6, is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This compound features a phenylmethyl group attached to the piperazinone moiety, contributing to its unique properties and potential biological activity. The (S)- designation indicates that it is a specific enantiomer, which can influence its pharmacological effects and interactions in biological systems. Piperazinones are often studied for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The compound may exhibit various characteristics such as solubility in organic solvents, stability under certain conditions, and specific reactivity patterns typical of piperazine derivatives. Its structural features suggest potential interactions with biological targets, making it of interest in research related to neuropharmacology and other therapeutic areas. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C11H14N2O
InChI:InChI=1/C11H14N2O/c14-11-10(12-6-7-13-11)8-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2,(H,13,14)/t10-/m0/s1
- Synonyms:
- (3S)-3-Benzylpiperazin-2-One
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (3S)-3-benzyl-2-piperazinone hydrochloride REF: 10-F358952CAS: 134676-49-6 | 95.0% | - - - | Discontinued product |
![]() | (3S)-3-Benzylpiperazin-2-one REF: 3D-JFA67649CAS: 134676-49-6 | Min. 95% | - - - | Discontinued product |

(3S)-3-benzyl-2-piperazinone hydrochloride
Ref: 10-F358952
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information |

(3S)-3-Benzylpiperazin-2-one
Ref: 3D-JFA67649
1g | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |