CAS 13491-41-3: 4-(hydroxyamino)-1-pentofuranosylpyrimidin-2(1H)-one

Description:4-(Hydroxyamino)-1-pentofuranosylpyrimidin-2(1H)-one, with the CAS number 13491-41-3, is a chemical compound that features a pyrimidine ring substituted with a hydroxyamino group and a pentofuranosyl moiety. This compound is characterized by its potential biological activity, particularly in the context of nucleoside analogs, which can influence nucleic acid metabolism. The presence of the hydroxyamino group suggests it may participate in various chemical reactions, including those involving nucleophilic attack or hydrogen bonding. Its structure indicates that it may exhibit solubility in polar solvents, which is typical for compounds containing hydroxyl and amino functional groups. Additionally, the pyrimidine core is known for its role in the structure of nucleotides and nucleic acids, suggesting that this compound may have relevance in biochemical pathways or therapeutic applications. Overall, its unique structural features and functional groups contribute to its potential utility in medicinal chemistry and biochemistry.

Formula:C₉H₁₃N₃O₆

InChI:InChI=1/C9H13N3O6/c13-3-4-6(14)7(15)8(18-4)12-2-1-5(11-17)10-9(12)16/h1-2,4,6-8,13-15,17H,3H2,(H,10,11,16)