CAS 134949-39-6: Butyl 2-amino-6-benzothiazolecarboxylate

Description:Butyl 2-amino-6-benzothiazolecarboxylate is an organic compound characterized by its benzothiazole structure, which features a fused benzene and thiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, owing to its hydrophobic butyl group. It is often utilized in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the amino and carboxylate functional groups suggests potential for hydrogen bonding and reactivity, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Butyl 2-amino-6-benzothiazolecarboxylate is a noteworthy compound in the realm of organic chemistry, particularly for its structural features and potential applications.

Formula:C₁₂H₁₄N₂O₂S

InChI:InChI=1S/C12H14N2O2S/c1-2-3-6-16-11(15)8-4-5-9-10(7-8)17-12(13)14-9/h4-5,7H,2-3,6H2,1H3,(H2,13,14)

InChI key:InChIKey=BITVLCPCCBVIQU-UHFFFAOYSA-N

SMILES:O=C(OCCCC)C=1C=CC=2N=C(SC2C1)N