CAS 1349716-20-6: 4-(3-Oxetanyloxy)benzonitrile

Description: 4-(3-Oxetanyloxy)benzonitrile is an organic compound characterized by its unique structural features, which include a benzonitrile moiety and an oxetane functional group. The presence of the nitrile group (-C≡N) indicates that it has a triple bond between carbon and nitrogen, contributing to its reactivity and potential applications in organic synthesis. The oxetane ring, a four-membered cyclic ether, adds to the compound's structural complexity and can influence its chemical behavior, including its stability and reactivity. This compound may exhibit interesting properties such as solubility in organic solvents, and its functional groups can participate in various chemical reactions, making it a candidate for use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of the aromatic ring can provide stability and influence the electronic properties of the molecule. Overall, 4-(3-Oxetanyloxy)benzonitrile is a compound of interest in the field of organic chemistry due to its distinctive structure and potential applications.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c11-5-8-1-3-9(4-2-8)13-10-6-12-7-10/h1-4,10H,6-7H2

InChI key: InChIKey=NWXAOSHVJHQPLH-UHFFFAOYSA-N

SMILES: N#CC1=CC=C(OC2COC2)C=C1

Synonyms:

• 4-(3-Oxetanyloxy)benzonitrile
• Benzonitrile, 4-(3-oxetanyloxy)-

4-(Oxetan-3-yloxy)benzonitrile

CAS: 1349716-20-6

• Molecular weight: 175.18699645996094

4-(Oxetan-3-yloxy)benzonitrile

CAS: 1349716-20-6

Versatile small molecule scaffold

• Formula: C₁₀H₉NO₂
• Purity: Min. 95%
• Molecular weight: 175.18 g/mol