CAS 134997-87-8: 3-Oxo-3,4-Dihydro-2H-1,4-Benzoxazine-6-Carboxylic Acid
Description:3-Oxo-3,4-Dihydro-2H-1,4-Benzoxazine-6-Carboxylic Acid, with the CAS number 134997-87-8, is a chemical compound that belongs to the class of benzoxazines, which are characterized by a fused benzene and oxazine ring structure. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in polymer chemistry. Its structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the presence of the keto group indicates potential for tautomerization and reactivity in various chemical reactions. Overall, 3-Oxo-3,4-Dihydro-2H-1,4-Benzoxazine-6-Carboxylic Acid is a versatile compound with unique properties that warrant further investigation.
Formula:C9H7NO4
InChI:InChI=1/C9H7NO4/c11-8-4-14-7-2-1-5(9(12)13)3-6(7)10-8/h1-3H,4H2,(H,10,11)(H,12,13)
- Synonyms:
- Timtec-Bb Sbb005401
- Buttpark 120\07-50
- Iflab-Bb F2124-0613
- 2H-1,4-Benzoxazine-6-Carboxylic Acid, 3,4-Dihydro-3-Oxo-
- 3-Oxo-3,4-Dihydro-2H-Benzo[1,4]Oxazine-6-Carboxylic Acid
- 3,4-Dihydro-3-Oxo-2H-1,4-Benzoxazine-6-Carboxylicacid
- -oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carboxylic acid

3-oxo-3,4-dihydro-2h-benzo[b][1,4]oxazine-6-carboxylic Acid
Ref: IN-DA0038XY
1g | 106.00 € | ||
5g | 223.00 € | ||
100mg | 46.00 € | ||
250mg | 66.00 € |

3,4-Dihydro-3-oxo-2H-1,4-benzoxazine-6-carboxylic acid
Ref: 54-OR110152
1g | 88.00 € | ||
5g | 270.00 € | ||
25g | 1,161.00 € |

3-Oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylic acid
Ref: 10-F066342
1g | 102.00 € | ||
5g | 304.00 € | ||
10g | 417.00 € | ||
25g | 816.00 € | ||
100mg | 40.00 € | ||
250mg | 57.00 € |

3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carboxylic Acid
Controlled ProductRef: TR-E588758
50mg | 92.00 € | ||
100mg | 131.00 € | ||
500mg | 343.00 € |

3-Oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylic acid
Ref: 3D-FO30873
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |