CAS 135-77-3: 1,2,4-Trimethoxybenzene
Description:1,2,4-Trimethoxybenzene, with the CAS number 135-77-3, is an aromatic compound characterized by the presence of three methoxy (-OCH3) groups attached to a benzene ring at the 1, 2, and 4 positions. This compound is a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its pleasant, sweet odor and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. The presence of multiple methoxy groups enhances its electron-donating properties, making it a potential candidate for various chemical reactions, including electrophilic substitutions. 1,2,4-Trimethoxybenzene is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, it exhibits interesting properties that can be explored in materials science and as a potential ligand in coordination chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.
Formula:C9H12O3
InChI:InChI=1S/C9H12O3/c1-10-7-4-5-8(11-2)9(6-7)12-3/h4-6H,1-3H3
InChI key:InChIKey=AGIQIOSHSMJYJP-UHFFFAOYSA-N
SMILES:O(C1=CC=C(OC)C(OC)=C1)C
- Synonyms:
- 1,2,4-Benzenetriol trimethyl ether
- 1,2,5-Trimethoxybenzene
- 1,3,4-Trimethoxybenzene
- 2,4-Dimethoxyanisole
- Benzene, 1,2,4-trimethoxy-
- Hydroxyhydroquinone trimethyl ether
- Tmb 124
- 1,2,4-Trimethoxybenzene
