CAS 1350885-67-4: 6-Bromo-8-methoxy-1,2,4-triazolo[4,3-a]pyrazine

Description: 6-Bromo-8-methoxy-1,2,4-triazolo[4,3-a]pyrazine is a heterocyclic compound characterized by its complex ring structure, which incorporates both triazole and pyrazine moieties. The presence of a bromine atom at the 6-position and a methoxy group at the 8-position contributes to its unique chemical properties and potential reactivity. This compound is typically synthesized through specific organic reactions that involve the formation of the triazole and pyrazine rings. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. Additionally, its molecular weight and specific physical properties, such as melting point and boiling point, are influenced by the substituents on the ring system. Overall, 6-Bromo-8-methoxy-1,2,4-triazolo[4,3-a]pyrazine represents a class of compounds that are valuable in medicinal chemistry and material science.

Formula: C₆H₅BrN₄O

InChI: InChI=1S/C6H5BrN4O/c1-12-6-5-10-8-3-11(5)2-4(7)9-6/h2-3H,1H3

InChI key: InChIKey=HDUURDGZJJWSFY-UHFFFAOYSA-N

SMILES: BrC=1N=C(OC)C2=NN=CN2C1

Synonyms:

• 6-Bromo-8-methoxy-1,2,4-triazolo[4,3-a]pyrazine
• 1,2,4-Triazolo[4,3-a]pyrazine, 6-bromo-8-methoxy-

6-Bromo-8-methoxy-[1,2,4]triazolo[4,3-a]pyrazine

CAS: 1350885-67-4

• Formula: C₆H₅BrN₄O
• Purity: 97%
• Color and Shape: Solid
• Molecular weight: 229.0341

6-Bromo-8-methoxy-[1,2,4]triazolo[4,3-a]pyrazine

CAS: 1350885-67-4

• Molecular weight: 229.03g/mol

6-Bromo-8-methoxy-[1,2,4]triazolo[4,3-a]pyrazine

CAS: 1350885-67-4

• Purity: 97%
• Molecular weight: 229.03700256347656

6-Bromo-8-methoxy-[1,2,4]triazolo[4,3-a]pyrazine

CAS: 1350885-67-4

Versatile small molecule scaffold

• Formula: C₆H₅BrN₄O
• Purity: Min. 95%
• Molecular weight: 229.03 g/mol