CAS 1351393-83-3: 3-[3-(1H-Indol-4-yl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropanecarboxylic acid

Description:3-[3-(1H-Indol-4-yl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropanecarboxylic acid is a complex organic compound characterized by its unique structural features, which include an indole moiety, an oxadiazole ring, and a cyclopropanecarboxylic acid group. The presence of the indole structure suggests potential biological activity, as indoles are known for their roles in various pharmacological applications. The oxadiazole ring contributes to the compound's stability and may enhance its electronic properties, making it of interest in medicinal chemistry. The cyclopropane ring, with its strained structure, can impart unique reactivity and steric effects, influencing the compound's interactions with biological targets. This compound may exhibit properties such as anti-inflammatory, antimicrobial, or anticancer activities, although specific biological data would be necessary to confirm these effects. Overall, the combination of these functional groups makes it a candidate for further research in drug development and materials science.

Formula:C₁₆H₁₅N₃O₃

InChI:InChI=1S/C16H15N3O3/c1-16(2)11(12(16)15(20)21)14-18-13(19-22-14)9-4-3-5-10-8(9)6-7-17-10/h3-7,11-12,17H,1-2H3,(H,20,21)

InChI key:InChIKey=GFGGBBWWIKSRMI-UHFFFAOYSA-N

SMILES:O=C(O)C1C(C2=NC(=NO2)C=3C=CC=C4NC=CC43)C1(C)C

Synonyms:
Cyclopropanecarboxylic acid, 3-[3-(1H-indol-4-yl)-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-
3-[3-(1H-Indol-4-yl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropanecarboxylic acid