CAS 13524-04-4: 1-(2-Chlorophenyl)ethanol
Description:1-(2-Chlorophenyl)ethanol, with the CAS number 13524-04-4, is an organic compound characterized by the presence of a chlorophenyl group attached to an ethanol moiety. This compound features a hydroxyl (-OH) functional group, which contributes to its classification as an alcohol. The chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring, specifically at the ortho position relative to the hydroxyl group. This substitution can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity. Typically, compounds like 1-(2-Chlorophenyl)ethanol exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, which can enhance solubility in polar solvents. Additionally, the presence of the chlorine atom can impart unique reactivity patterns, making it of interest in various chemical syntheses and applications. Overall, this compound is relevant in fields such as pharmaceuticals, agrochemicals, and materials science, where its specific properties can be leveraged for diverse applications.
Formula:C8H9ClO
InChI:InChI=1S/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3
InChI key:InChIKey=DDUBOVLGCYUYFX-UHFFFAOYSA-N
SMILES:ClC=1C=CC=CC1C(O)C
- Synonyms:
- (1R)-1-(2-chlorophenyl)ethanol
- (1S)-1-(2-chlorophenyl)ethanol
- (±)-1-(o-Chlorophenyl)ethanol
- 1-(2-Chlorophenyl)-1-ethanol
- 2-Chloro-alpha-methylbenzyl alcohol
- 2-Chloro-α-methylbenzenemethanol
- Benzenemethanol, 2-chloro-α-methyl-
- Benzyl alcohol, o-chloro-α-methyl-
- α-(o-Chlorophenyl)ethanol
- 1-(2-Chlorophenyl)ethanol
- See more synonyms
