CAS 1353944-63-4: N1-Ethyl-N2-methyl-N1-(phenylmethyl)-1,2-cyclohexanediamine

Description:N^1-Ethyl-N^2-methyl-N^1-(phenylmethyl)-1,2-cyclohexanediamine is a chemical compound characterized by its complex structure, which includes a cyclohexane ring with two amine functional groups and various alkyl and aryl substituents. This compound features a cyclohexanediamine backbone, indicating the presence of two amine (-NH2) groups, which can participate in hydrogen bonding and influence its solubility and reactivity. The ethyl and methyl groups contribute to its hydrophobic character, while the phenylmethyl group adds aromatic characteristics, potentially affecting its interaction with biological systems. The presence of multiple functional groups suggests that this compound may exhibit diverse chemical reactivity, including potential for forming salts or participating in nucleophilic reactions. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the steric effects of the substituents. Overall, this compound may have applications in medicinal chemistry or as a building block in organic synthesis, although detailed studies would be necessary to fully understand its behavior and potential uses.

Formula:C₁₆H₂₆N₂

InChI:InChI=1S/C16H26N2/c1-3-18(13-14-9-5-4-6-10-14)16-12-8-7-11-15(16)17-2/h4-6,9-10,15-17H,3,7-8,11-13H2,1-2H3

InChI key:InChIKey=PCWRYKOPEHXTFB-UHFFFAOYSA-N

SMILES:C=1C=CC(=CC1)CN(CC)C2CCCCC2NC

Synonyms:
1,2-Cyclohexanediamine, N1-ethyl-N2-methyl-N1-(phenylmethyl)-
N1-Ethyl-N2-methyl-N1-(phenylmethyl)-1,2-cyclohexanediamine

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	N-Benzyl-N-ethyl-N'-methyl-cyclohexane-1,2-diamine REF: 10-F088076CAS: 1353944-63-4	- - -	- - -	Discontinued product
	N-Benzyl-N-ethyl-N'-methyl-cyclohexane-1,2-diamine REF: 3D-DEC94463CAS: 1353944-63-4	Min. 95%	- - -	Discontinued product