CAS 1353965-51-1: N1-Cyclopropyl-N1-[(2,3-dichlorophenyl)methyl]-1,2-ethanediamine
Description:N1-Cyclopropyl-N1-[(2,3-dichlorophenyl)methyl]-1,2-ethanediamine is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a dichlorophenyl moiety attached to an ethanediamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of amino groups. The cyclopropyl ring contributes to its steric properties, potentially influencing its reactivity and interaction with biological targets. The dichlorophenyl group may enhance lipophilicity, affecting the compound's solubility and permeability in biological systems. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, which may include acting as a ligand or inhibitor in various biochemical pathways. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can pose health risks.
Formula:C12H16Cl2N2
InChI:InChI=1S/C12H16Cl2N2/c13-11-3-1-2-9(12(11)14)8-16(7-6-15)10-4-5-10/h1-3,10H,4-8,15H2
InChI key:InChIKey=DDBRVYAYCAESDG-UHFFFAOYSA-N
SMILES:ClC1=CC=CC(=C1Cl)CN(CCN)C2CC2
- Synonyms:
- N1-Cyclopropyl-N1-[(2,3-dichlorophenyl)methyl]-1,2-ethanediamine
- 1,2-Ethanediamine, N1-cyclopropyl-N1-[(2,3-dichlorophenyl)methyl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N*1*-Cyclopropyl-N*1*-(2,3-dichloro-benzyl)-ethane-1,2-diamine REF: 10-F086209CAS: 1353965-51-1 | - - - | - - - | Discontinued product |
![]() | N'-Cyclopropyl-N'-[(2,3-dichlorophenyl)methyl]ethane-1,2-diamine REF: 3D-DEC96551CAS: 1353965-51-1 | Min. 95% | - - - | Discontinued product |

N*1*-Cyclopropyl-N*1*-(2,3-dichloro-benzyl)-ethane-1,2-diamine
Ref: 10-F086209
500mg | Discontinued | Request information |

N'-Cyclopropyl-N'-[(2,3-dichlorophenyl)methyl]ethane-1,2-diamine
Ref: 3D-DEC96551
1g | Discontinued | Request information | |
5g | Discontinued | Request information |