CAS 1353972-21-0: 6-Chloro-N-methyl-3-pyridazinemethanamine

Description: 6-Chloro-N-methyl-3-pyridazinemethanamine is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and a methyl group attached to the nitrogen at the 1-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with other molecules. The specific arrangement of substituents on the pyridazine ring can affect its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's CAS number, 1353972-21-0, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, 6-Chloro-N-methyl-3-pyridazinemethanamine represents a class of compounds that may have potential uses in pharmaceuticals or agrochemicals, warranting further investigation into its properties and applications.

Formula: C₆H₈ClN₃

InChI: InChI=1S/C6H8ClN3/c1-8-4-5-2-3-6(7)10-9-5/h2-3,8H,4H2,1H3

InChI key: InChIKey=CJELPEWENZDCAJ-UHFFFAOYSA-N

SMILES: ClC1=NN=C(C=C1)CNC

Synonyms:

• 3-Pyridazinemethanamine, 6-chloro-N-methyl-
• 6-Chloro-N-methyl-3-pyridazinemethanamine

(6-Chloro-pyridazin-3-ylmethyl)-methyl-amine

CAS: 1353972-21-0

• Molecular weight: 157.60000610351562

(6-Chloro-pyridazin-3-ylmethyl)-methyl-amine

CAS: 1353972-21-0

Versatile small molecule scaffold

• Formula: C₆H₈ClN₃
• Purity: Min. 95%
• Molecular weight: 157.6 g/mol