CAS 1354954-21-4: Cyclopentanemethanol, 2-amino-1-methyl-
Description:Cyclopentanemethanol, 2-amino-1-methyl- is an organic compound characterized by its unique structure, which includes a cyclopentane ring and an amino group. This compound features a hydroxymethyl group (-CH2OH) attached to the cyclopentane, along with an amino group (-NH2) and a methyl group (-CH3) on the same carbon. The presence of these functional groups suggests that it may exhibit properties typical of alcohols and amines, such as hydrogen bonding capabilities, which can influence its solubility in polar solvents. The molecular structure contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may have applications in pharmaceuticals or as an intermediate in organic synthesis due to its functional diversity. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Overall, Cyclopentanemethanol, 2-amino-1-methyl- represents a versatile compound within organic chemistry.
Formula:C7H15NO
InChI:InChI=1S/C7H15NO/c1-7(5-9)4-2-3-6(7)8/h6,9H,2-5,8H2,1H3
InChI key:InChIKey=VGJDOVOKSWFTCD-UHFFFAOYSA-N
SMILES:OCC1(C)CCCC1N
- Synonyms:
- 2-Amino-1-methylcyclopentanemethanol
- Cyclopentanemethanol, 2-amino-1-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (2-Amino-1-methylcyclopentyl)methanol REF: 10-F748174CAS: 1354954-21-4 | 95% | - - - | Discontinued product |
![]() | (2-Amino-1-methylcyclopentyl)methanol REF: 3D-EEC95421CAS: 1354954-21-4 | Min. 95% | - - - | Discontinued product |

Ref: 10-F748174
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

(2-Amino-1-methylcyclopentyl)methanol
Ref: 3D-EEC95421
25mg | Discontinued | Request information | |
250mg | Discontinued | Request information |