CAS 13550-89-5: 1,3,5-Triazine-2,4,6-triamine-N2,N2,N4,N4,N6,N6-d6

Description:1,3,5-Triazine-2,4,6-triamine-N2,N2,N4,N4,N6,N6-d6, commonly known as deuterated melamine, is a nitrogen-rich organic compound characterized by its triazine ring structure. This compound features three amino groups attached to a 1,3,5-triazine core, which contributes to its high thermal stability and potential applications in various fields, including materials science and agriculture. The presence of deuterium isotopes (d6) indicates that hydrogen atoms in the amino groups have been replaced with deuterium, which can be useful in studies involving nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques. The compound is typically white crystalline in appearance and is soluble in water and polar solvents. Its high nitrogen content makes it an interesting candidate for use as a flame retardant and in the synthesis of polymers. Additionally, due to its structural properties, it may also exhibit interesting biological activities, although specific applications would depend on further research and development.

Formula:C₃D₆N₆

InChI:InChI=1S/C3H6N6/c4-1-7-2(5)9-3(6)8-1/h(H6,4,5,6,7,8,9)/i/hD6

InChI key:InChIKey=JDSHMPZPIAZGSV-YIKVAAQNSA-N

SMILES:N=1C(=NC(=NC1N)N)N