CAS 1355248-05-3: 1-(4-Formylphenyl)-3-azetidinecarboxylic acid

Description:1-(4-Formylphenyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes an azetidine ring and a formylphenyl group. The azetidine ring is a four-membered saturated heterocycle containing one nitrogen atom, contributing to the compound's potential biological activity. The presence of the formyl group (–CHO) on the phenyl ring indicates that this compound can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the carboxylic acid functional group (–COOH) enhances its solubility in polar solvents and allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit interesting properties, including potential antimicrobial or anti-inflammatory activities, although specific biological data would be required to confirm such effects. Overall, 1-(4-Formylphenyl)-3-azetidinecarboxylic acid represents a versatile scaffold for further chemical modifications and applications in drug development.

Formula:C₁₁H₁₁NO₃

InChI:InChI=1S/C11H11NO3/c13-7-8-1-3-10(4-2-8)12-5-9(6-12)11(14)15/h1-4,7,9H,5-6H2,(H,14,15)

InChI key:InChIKey=JBVARJKZZNPSDV-UHFFFAOYSA-N

SMILES:O=CC1=CC=C(C=C1)N2CC(C(=O)O)C2

Synonyms:
1-(4-Formylphenyl)-3-azetidinecarboxylic acid
3-Azetidinecarboxylic acid, 1-(4-formylphenyl)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1-(4-Formylphenyl)azetidine-3-carboxylic acid REF: IN-DA007LDKCAS: 1355248-05-3	98%	To inquire	Thu 27 Mar 25
1-(4-Formylphenyl)azetidine-3-carboxylic acid REF: 10-F236342CAS: 1355248-05-3	95.0%	To inquire	Tue 08 Apr 25
1-(4-Formylphenyl)azetidine-3-carboxylic acid REF: 3D-FEC24805CAS: 1355248-05-3	Min. 95 Area-%	140.00 €~947.00 €	Mon 07 Apr 25