CAS 135548-15-1: Oxeclosporin
Description:Oxeclosporin, with the CAS number 135548-15-1, is a synthetic compound that belongs to the class of immunosuppressants, specifically a derivative of cyclosporine. It is primarily characterized by its ability to inhibit T-cell activation and proliferation, making it useful in the context of organ transplantation and autoimmune diseases. Oxeclosporin exhibits a unique mechanism of action by binding to specific intracellular proteins, which subsequently modulate the immune response. The compound is typically administered in a formulation that enhances its bioavailability and therapeutic efficacy. Its pharmacokinetic properties include a relatively long half-life, allowing for less frequent dosing compared to other immunosuppressants. Additionally, Oxeclosporin has been studied for its potential side effects, which may include nephrotoxicity and increased susceptibility to infections, common among immunosuppressive therapies. Overall, Oxeclosporin represents a significant advancement in the management of conditions requiring immune modulation, although careful monitoring is essential to mitigate adverse effects.
Formula:C64H115N11O14
InChI:InChI=1/C64H115N11O14/c1-24-26-27-42(15)54(78)53-58(82)66-44(25-2)59(83)69(17)34-50(77)70(18)46(30-36(3)4)57(81)68-51(40(11)12)63(87)71(19)47(31-37(5)6)56(80)65-43(16)55(79)67-45(35-89-29-28-76)60(84)72(20)48(32-38(7)8)61(85)73(21)49(33-39(9)10)62(86)74(22)52(41(13)14)64(88)75(53)23/h24,26,36-49,51-54,76,78H,25,27-35H2,1-23H3,(H,65,80)(H,66,82)(H,67,79)(H,68,81)/b26-24+/t42-,43+,44+,45-,46+,47+,48+,49+,51+,52+,53+,54-/m1/s1
- Synonyms:
- (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-12-[(2-hydroxyethoxy)methyl]-33-[(1R,2R,4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,15,19,25,28-octamethyl-3,21-bis(1-methylethyl)-6,9,18,24-tetrakis(2-methylpropyl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
- SDZ IMM 125
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Oxeclosporin REF: TM-T70889CAS: 135548-15-1 | - - - | 7,287.00 €~14,060.00 € | Thu 26 Jun 25 |

Oxeclosporin
Ref: TM-T70889
25mg | 7,287.00 € | ||
50mg | 9,672.00 € | ||
100mg | 14,060.00 € |