CAS 13575-86-5: 6-aminotetralin-2,3-diol

Description:6-Aminotetralin-2,3-diol is an organic compound characterized by its structure, which includes a tetralin core with amino and diol functional groups. This compound features a six-membered bicyclic structure, specifically a naphthalene derivative, with an amino group (-NH2) and two hydroxyl groups (-OH) located at the 2 and 3 positions of the ring. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl groups. The amino group can participate in hydrogen bonding, enhancing its solubility in water and other polar solvents. 6-Aminotetralin-2,3-diol may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its potential applications could include serving as a precursor in the synthesis of various pharmaceuticals or as a research tool in studying biological pathways. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.

Formula:C₁₀H₁₄BrNO₂

InChI:InChI=1/C10H13NO2.BrH/c11-8-2-1-6-4-9(12)10(13)5-7(6)3-8;/h4-5,8,12-13H,1-3,11H2;1H