CAS 1357946-44-1: 2-Bromo-5-fluoro-3-(methylthio)pyridine
Description:2-Bromo-5-fluoro-3-(methylthio)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom, a fluorine atom, and a methylthio group. The molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The bromine and fluorine substituents introduce significant electronegativity, influencing the compound's reactivity and polarity. The methylthio group enhances the compound's nucleophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Overall, 2-Bromo-5-fluoro-3-(methylthio)pyridine is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C6H5BrFNS
InChI:InChI=1S/C6H5BrFNS/c1-10-5-2-4(8)3-9-6(5)7/h2-3H,1H3
InChI key:InChIKey=HAXAGOWQZKIMTG-UHFFFAOYSA-N
SMILES:FC1=CN=C(Br)C(SC)=C1
- Synonyms:
- 2-Bromo-5-fluoro-3-(methylthio)pyridine
- Pyridine, 2-bromo-5-fluoro-3-(methylthio)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Bromo-5-fluoro-3-(methylthio)pyridine REF: FT-G14830CAS: 1357946-44-1 | >95% | To inquire | Tue 01 Apr 25 |
![]() | 2-Bromo-5-fluoro-3-(methylthio)pyridine REF: 10-F768939CAS: 1357946-44-1 | 98% | - - - | Discontinued product |
![]() | 2-Bromo-5-fluoro-3-(methylthio)pyridine REF: 3D-HEC94644CAS: 1357946-44-1 | Min. 95% | - - - | Discontinued product |

Ref: FT-G14830
1g | To inquire | ||
250mg | To inquire |

Ref: 10-F768939
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2-Bromo-5-fluoro-3-(methylthio)pyridine
Ref: 3D-HEC94644
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |