CAS 135897-06-2: 5,6,7,8-tetrahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-13,15(14H)-dione
Description:5,6,7,8-tetrahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-13,15(14H)-dione, with CAS number 135897-06-2, is a complex organic compound characterized by its unique polycyclic structure, which includes multiple fused rings and nitrogen atoms. This compound features a triazole moiety, contributing to its potential biological activity. The presence of epoxy groups indicates that it may participate in various chemical reactions, including nucleophilic attacks. Its intricate arrangement of carbon and nitrogen atoms suggests potential applications in materials science, organic electronics, or as a dye, although specific applications may depend on its solubility and stability. The compound's synthesis and reactivity are of interest in organic chemistry, particularly in the development of novel compounds with specific electronic or optical properties. Further studies would be necessary to fully elucidate its properties, including its spectral characteristics, reactivity, and potential uses in various fields.
Formula:C24H15N3O3
InChI:InChI=1/C24H15N3O3/c28-23-19-17-11-5-1-3-7-13(11)26-15-9-10-16(30-15)27-14-8-4-2-6-12(14)18(22(27)21(17)26)20(19)24(29)25-23/h1-8,15-16H,9-10H2,(H,25,28,29)
- Synonyms:
- 28-Oxa-4,14,19-triazaoctacyclo[12.11.2.115,18
- Sb-218078
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | SB 218078 REF: TR-S155068CAS: 135897-06-2 | - - - | 3,864.00 € | Wed 07 May 25 |
![]() | SB 218078 REF: 3D-BS162793CAS: 135897-06-2 | Min. 95% | 2,250.00 € | Thu 08 May 25 |
![]() | SB-218078 REF: TM-T16848CAS: 135897-06-2 | 98% | 293.00 €~1,700.00 € | Thu 15 May 25 |

SB 218078
Controlled ProductRef: TR-S155068
50mg | 3,864.00 € |

SB 218078
Ref: 3D-BS162793
10mg | 2,250.00 € |

SB-218078
Ref: TM-T16848
1mg | 335.00 € |