CAS 136030-33-6: N-FMOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid
Description:N-FMOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid is a chemical compound characterized by its structure, which includes a tetrahydroisoquinoline core, a carboxylic acid functional group, and a 9-fluorenylmethoxycarbonyl (FMOC) protecting group. This compound is often utilized in organic synthesis and peptide chemistry, particularly for the protection of amino acids during peptide synthesis. The FMOC group is favored for its stability under basic conditions and ease of removal under mild acidic conditions, making it a valuable tool in the synthesis of complex molecules. The presence of the tetrahydroisoquinoline moiety contributes to its potential biological activity, as isoquinoline derivatives are known for various pharmacological properties. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, which is essential for its application in synthetic pathways. Overall, N-FMOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid serves as an important intermediate in the development of bioactive compounds and pharmaceuticals.
Formula:C25H20NO4
InChI:InChI=1/C25H21NO4/c27-24(28)23-13-16-7-1-2-8-17(16)14-26(23)25(29)30-15-22-20-11-5-3-9-18(20)19-10-4-6-12-21(19)22/h1-12,22-23H,13-15H2,(H,27,28)/p-1/t23-/m0/s1
- Synonyms:
- Fmoc-L-Tetrahydroisoquinoline-3-COOH
- Fmoc-Tic-OH
- Fmoc-L-Tic-OH