CAS 1363166-44-2: 3-Ethyl 1-(phenylmethyl) 3-(2-propen-1-yl)-1,3-piperidinedicarboxylate
Description:3-Ethyl 1-(phenylmethyl) 3-(2-propen-1-yl)-1,3-piperidinedicarboxylate is a complex organic compound characterized by its piperidine core, which features two carboxylate ester groups and various substituents that contribute to its chemical properties. The presence of an ethyl group and a phenylmethyl group enhances its hydrophobic characteristics, while the propenyl substituent introduces potential for reactivity, particularly in addition reactions or polymerization processes. This compound may exhibit moderate to high lipophilicity, influencing its solubility in organic solvents compared to water. Its structure suggests potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of biologically active molecules. The compound's reactivity can be attributed to the presence of the double bond in the propenyl group, which may participate in various chemical reactions. Additionally, the piperidine ring can influence the compound's pharmacological properties, making it of interest in drug development. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.
Formula:C19H25NO4
InChI:InChI=1S/C19H25NO4/c1-3-11-19(17(21)23-4-2)12-8-13-20(15-19)18(22)24-14-16-9-6-5-7-10-16/h3,5-7,9-10H,1,4,8,11-15H2,2H3
InChI key:InChIKey=UNCPFQLCMLNOSJ-UHFFFAOYSA-N
SMILES:O=C(OCC=1C=CC=CC1)N2CCCC(C(=O)OCC)(CC=C)C2
- Synonyms:
- 1,3-Piperidinedicarboxylic acid, 3-(2-propen-1-yl)-, 3-ethyl 1-(phenylmethyl) ester
- 3-Ethyl 1-(phenylmethyl) 3-(2-propen-1-yl)-1,3-piperidinedicarboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1,3-Piperidinedicarboxylic acid, 3-(2-propen-1-yl)-, 3-ethyl 1-(phenylmethyl) ester REF: IN-DA0011MECAS: 1363166-44-2 | - - - | To inquire | Tue 11 Mar 25 |
 | Ethyl 1-Cbz-3-allylpiperidine-3-carboxylate REF: 54-OR470457CAS: 1363166-44-2 | - - - | To inquire | Tue 18 Mar 25 |
 | 1-Benzyl 3-ethyl 3-allylpiperidine-1,3-dicarboxylate REF: 10-F677647CAS: 1363166-44-2 | 95+% | - - - | Discontinued product |
 | Ethyl 1-cbz-3-allylpiperidine-3-carboxylate REF: 3D-NEC16644CAS: 1363166-44-2 | Min. 95% | - - - | Discontinued product |
1,3-Piperidinedicarboxylic acid, 3-(2-propen-1-yl)-, 3-ethyl 1-(phenylmethyl) ester
Ref: IN-DA0011ME
| Undefined size | To inquire |
Ref: 54-OR470457
| Undefined size | To inquire |
1-Benzyl 3-ethyl 3-allylpiperidine-1,3-dicarboxylate
Ref: 10-F677647
| 5g | Discontinued | Request information |
Ethyl 1-cbz-3-allylpiperidine-3-carboxylate
Ref: 3D-NEC16644
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 5mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
