CAS 1364917-22-5: 2H-Pyrano[3,2-b]pyridine-8-carboxylic acid, 3,4-dihydro-

Description: 2H-Pyrano[3,2-b]pyridine-8-carboxylic acid, 3,4-dihydro- is a heterocyclic organic compound characterized by its fused pyran and pyridine rings. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the dihydro configuration indicates that it has two hydrogen atoms added to the pyridine ring, affecting its stability and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural complexity allows for various interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. As with many heterocycles, it may also participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₉H₉NO₃

InChI: InChI=1S/C9H9NO3/c11-9(12)6-3-4-10-7-2-1-5-13-8(6)7/h3-4H,1-2,5H2,(H,11,12)

InChI key: InChIKey=WWRKLFILMFKNIN-UHFFFAOYSA-N

SMILES: O=C(O)C=1C=CN=C2C1OCCC2

Synonyms:

• 2H-Pyrano[3,2-b]pyridine-8-carboxylic acid, 3,4-dihydro-
• 3,4-Dihydro-2H-pyrano[3,2-b]pyridine-8-carboxylic acid

3,4-Dihydro-2H-pyrano[3,2-b]pyridine-8-carboxylic acid

CAS: 1364917-22-5

• Purity: 98+%
• Molecular weight: 179.1750030517578

3,4-Dihydro-2h-pyrano[3,2-b]pyridine-8-carboxylic acid

CAS: 1364917-22-5

Versatile small molecule scaffold

• Formula: C₉H₉NO₃
• Purity: Min. 95%
• Molecular weight: 179.17 g/mol